Lincomycin HCl
Lincomycin HCl is a lincosamide antibiotic that comes from the actinomycete Streptomyces lincolnensis, used to treat severe bacterial infections in people who cannot use penicillin antibiotics.
| Trivial name | NSC 70731; U 10149A |
| Catalog Number | CSN11303 |
| Alternative Name(s) | NSC 70731; U 10149A |
| Research Area | Infection |
| Molecular Formula | C18H35ClN2O6S |
| CAS# | 859-18-7 |
| Purity | ≥99% |
| SMILES | C[C@@H](O)[C@@]([C@@]([C@@H]([C@H](O)[C@H]1O)O)([H])O[C@@H]1SC)([H])NC([C@@H]2C[C@@H](CCC)CN2C)=O.Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/lincomycin-hcl.html |