Bekanamycin
Bekanamycin is an aminoglycoside antibiotic acting through irreversibly binding to the bacterial 30S ribosomal subunit, leading to interference with translational initiation complex, misreading of mRNA, thereby hampering protein synthesis.

Trivial name | Kanamycin-B |
Catalog Number | CSN11246 |
Alternative Name(s) | Kanamycin-B |
Research Area | Infection |
Molecular Formula | C18H37N5O10 |
CAS# | 4696-76-8 |
Purity | ≥98% |
SMILES | O[C@H]1[C@](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@@]3([H])O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)([H])O[C@H](CO)[C@@H](O)[C@@H]1N |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/bekanamycin.html |