Bekanamycin
Bekanamycin is an aminoglycoside antibiotic acting through irreversibly binding to the bacterial 30S ribosomal subunit, leading to interference with translational initiation complex, misreading of mRNA, thereby hampering protein synthesis.
| Trivial name | Kanamycin-B |
| Catalog Number | CSN11246 |
| Alternative Name(s) | Kanamycin-B |
| Research Area | Infection |
| Molecular Formula | C18H37N5O10 |
| CAS# | 4696-76-8 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@](O[C@H]2[C@H](N)C[C@H](N)[C@@H](O[C@@]3([H])O[C@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)([H])O[C@H](CO)[C@@H](O)[C@@H]1N |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/bekanamycin.html |