Imidazolidinyl Urea
Imidazolidinyl Urea is one of the most widely used preservative systems in the world and is commonly found in cosmetics as an antimicrobial preservative.
| Trivial name | Imidurea |
| Catalog Number | CSN11194 |
| Alternative Name(s) | Imidurea |
| Research Area | Infection |
| Molecular Formula | C11H16N8O8 |
| CAS# | 39236-46-9 |
| Purity | ≥98% |
| SMILES | O=C(NC(C(N1)=O)N(CO)C1=O)NCNC(NC(C(N2)=O)N(CO)C2=O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/imidazolidinyl-urea.html |
