Met-Enkephalin
Met-enkephalin is an Opioid related peptide work as a potent agonist of the δ-opioid receptor, and to a lesser extent the μ-opioid receptor, with little to no effect on the κ-opioid receptor.
| Trivial name | H-Tyr-Gly-Gly-Phe-Met-OH |
| Catalog Number | CSN11162 |
| Alternative Name(s) | H-Tyr-Gly-Gly-Phe-Met-OH |
| Research Area | Neurological Disease |
| Molecular Formula | C27H35N5O7S |
| CAS# | 58569-55-4 |
| Purity | ≥99% |
| SMILES | O=C(O)[C@H](CCSC)NC([C@H](CC1=CC=CC=C1)NC(CNC(CNC([C@@H](N)CC2=CC=C(O)C=C2)=O)=O)=O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/met-enkephalin.html |
