Guanabenz Acetate
Guanabenz acetate is a centrally-acting α-2 adrenergic receptor agonist that is used as an antihypertensive drug to treat hypertension.
| Trivial name | WY 8678 Acetate |
| Catalog Number | CSN11125 |
| Alternative Name(s) | WY 8678 Acetate |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C10H12Cl2N4O2 |
| CAS# | 23256-50-0 |
| Purity | ≥99% |
| SMILES | ClC1=C(/C=N/NC(N)=N)C(Cl)=CC=C1.CC(O)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/guanabenz-acetate.html |
