Febuxostat
Febuxostat is an inhibitor of xanthine oxidase with Ki of 0.6 nM and can affect the progression of renal disease.
| Trivial name | TMX 67; TEI 6720; FBX |
| Catalog Number | CSN10987 |
| Alternative Name(s) | TMX 67; TEI 6720; FBX |
| Research Area | Metabolic Disease |
| Molecular Formula | C16H16N2O3S |
| CAS# | 144060-53-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(C)N=C(C2=CC=C(OCC(C)C)C(C#N)=C2)S1)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/febuxostat.html |