Epimedin C
Epmedin C has an effect similar to estrogene and stimulation of osteoblasts. Epmedin C is a natural flavonoid extract from Epimedium sagittatum.
| Trivial name | Baohuoside VI |
| Catalog Number | CSN10919 |
| Alternative Name(s) | Baohuoside VI |
| Research Area | / |
| Molecular Formula | C39H50O19 |
| CAS# | 110642-44-9 |
| Purity | ≥99% |
| SMILES | O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O)OC2=CC(O)=C3C(C(O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O[C@@]5(O[C@H]([C@@H]([C@H]([C@H]5O)O)O)C)[H])=C(OC3=C2C/C=C(C)\C)C6=CC=C(C=C6)OC)=O)CO)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/epimedin-c.html |
