Ellagic Acid
Ellagic acid is a potent and cell permeable casein kinase 2 (CK2) inhibitor with Ki of 20 nM, acts as a potent antioxidant and anti-mutagenic.
| Trivial name | Elagostasine; Gallogen; Lagistase |
| Catalog Number | CSN10902 |
| Alternative Name(s) | Elagostasine; Gallogen; Lagistase |
| Research Area | Cancer |
| Molecular Formula | C14H6O8 |
| CAS# | 476-66-4 |
| Purity | ≥99% |
| SMILES | O=C1C2=CC(O)=C(O)C(O3)=C2C4=C(O1)C(O)=C(O)C=C4C3=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/ellagic-acid.html |