Dyclonine HCl
Dyclonine HCl is the HCl form of dyclonine which can reversibly bind to activated sodium channels on the neuronal membrane. It is an anaesthetic found in sucrets.
| Trivial name | / |
| Catalog Number | CSN10881 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C18H28ClNO2 |
| CAS# | 536-43-6 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC=C(OCCCC)C=C1)CCN2CCCCC2.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dyclonine-hcl.html |