DL-Carnitine HCl
DL-Carnitine HCl has multiple function as a constituent of striated muscle and liver, an amino acid derivative and an essential cofactor for fatty acid metabolism.
Trivial name | (±)-Carnitine Chloride |
Catalog Number | CSN10844 |
Alternative Name(s) | (±)-Carnitine Chloride |
Research Area | / |
Molecular Formula | C7H16ClNO3 |
CAS# | 461-05-2 |
Purity | ≥98% |
SMILES | OC(C[N+](C)(C)C)CC([O-])=O.[H]Cl |
Size | 50mg |
Supplier Page | https://www.csnpharm.com/products/dl-carnitine-hcl.html |