Diphenmanil Methylsulfate
Diphemanil methylsulfate can bind the muscarinic M3 receptor and decrease secretory excretion of stomach acids and saliva and sweat, as well as works as a direct smooth muscle spasmolytic activity.
| Trivial name | Diphemanil Mesylate |
| Catalog Number | CSN10833 |
| Alternative Name(s) | Diphemanil Mesylate |
| Research Area | Endocrinology |
| Molecular Formula | C21H27NO4S |
| CAS# | 62-97-5 |
| Purity | ≥99% |
| SMILES | [O-]S(=O)(OC)=O.C[N+]1(C)CC/C(CC1)=C(C2=CC=CC=C2)\C3=CC=CC=C3 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/diphenmanil-methylsulfate.html |