Dexmedetomidine
Dexmedetomidine is a new generation highly selective α2-adrenergic receptor (α2-AR) agonist with Ki value of 1.08 nM, which is associated with sedative and analgesic sparing effects, reduced delirium and agitation, perioperative sympatholysis, cardiovascular stabilizing effects, and preservation of respiratory function.
| Trivial name | / |
| Catalog Number | CSN10784 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C13H16N2 |
| CAS# | 113775-47-6 |
| Purity | ≥99% |
| SMILES | C[C@H](C1=CN=CN1)C2=CC=CC(C)=C2C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/dexmedetomidine.html |
