Deoxycholic Acid
Deoxycholic Acid is a proinflammatory agent and used in a study to investigate dose-dependent anti-inflammatory effect of ursodeoxycholic acid in experimental colitis.
| Trivial name | Deoxycholate; Cholanoic Acid; Desoxycholic Acid; ATX-101 |
| Catalog Number | CSN10769 |
| Alternative Name(s) | Deoxycholate; Cholanoic Acid; Desoxycholic Acid; ATX-101 |
| Research Area | / |
| Molecular Formula | C24H40O4 |
| CAS# | 83-44-3 |
| Purity | ≥98% |
| SMILES | C[C@@]1([C@@]2([H])[C@H](C)CCC(O)=O)[C@](CC2)([H])[C@@](CC[C@@]3([H])[C@@]4(CC[C@@H](O)C3)C)([H])[C@]4([H])C[C@@H]1O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/deoxycholic-acid.html |
