Cefoperazone
Cefoperazone is a third-generation β-lactam cephalosporin antibiotic which can bind to specific penicillin-binding proteins (PBPs) located inside the bacterial cell wall, causing the inhibition of the third and last stage of bacterial cell wall synthesis.
| Trivial name | / |
| Catalog Number | CSN10575 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C25H27N9O8S2 |
| CAS# | 62893-19-0 |
| Purity | ≥99% |
| SMILES | O=C(C(N12)=C(CSC3=NN=NN3C)CS[C@]2([H])[C@H](NC([C@H](NC(N4C(C(N(CC)CC4)=O)=O)=O)C5=CC=C(O)C=C5)=O)C1=O)O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/cefoperazone.html |