Cefdinir
Cefdinir is a semi-synthetic, broad-spectrum antibiotic in the third generation of the cephalosporin class, which is effective for common bacterial infections of the ear, sinus, throat, and skin.
| Trivial name | FK 482; PD-134393; CI 983 |
| Catalog Number | CSN10567 |
| Alternative Name(s) | FK 482; PD-134393; CI 983 |
| Research Area | Infection |
| Molecular Formula | C14H13N5O5S2 |
| CAS# | 91832-40-5 |
| Purity | ≥99% |
| SMILES | O=C(C(N12)=C(C=C)CS[C@]2([H])[C@H](NC(/C(C3=CSC(N)=N3)=N\O)=O)C1=O)O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/cefdinir.html |