Capreomycin Sulfate
Capreomycin Sulfate is a polypeptide antibiotic obtained from Streptomyces capreolus, which can inhibit bacterial protein synthesis by binding to 30S and 50S ribosomal subunits. It has emerged as the first-line injectable agent in regimens for the treatment of drug-resistant tuberculosis.
| Trivial name | Caprocin |
| Catalog Number | CSN10539 |
| Alternative Name(s) | Caprocin |
| Research Area | Infection |
| Molecular Formula | C24H44N14O12S |
| CAS# | 1405-37-4 |
| Purity | ≥99% |
| SMILES | O=S(O)(O)=O.O=C(NC[C@@H](C(N/C(C(N[C@@H](C1CCN=C(N)N1)C(NC[C@@H]2N)=O)=O)=C\NC(N)=O)=O)NC([C@H](CO)NC2=O)=O)[C@@H](N)CCCN |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/capreomycin-sulfate.html |