Caffeic Acid Phenethyl Ester
Caffeic acid phenethyl ester, a natural product isolated and purified from the barks of Cinnamomum cassia Presl, is a potent and specific inhibitor of NF-κB activation, and also displays antioxidant, immunomodulatory and antiinflammatory activities.
| Trivial name | CAPE |
| Catalog Number | CSN10538 |
| Alternative Name(s) | CAPE |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C17H16O4 |
| CAS# | 104594-70-9 |
| Purity | ≥99% |
| SMILES | O=C(OCCC1=CC=CC=C1)/C=C/C2=CC=C(O)C(O)=C2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/caffeic-acid-phenethyl-ester.html |
