Butenafine HCl
Butenafine HCl is a synthetic benzylamine antifungal targeting on squalene epoxidase working by inhibiting the synthesis of ergosterol needed in fungal cell membranes.
| Trivial name | KP-363 |
| Catalog Number | CSN10517 |
| Alternative Name(s) | KP-363 |
| Research Area | Infection |
| Molecular Formula | C23H28ClN |
| CAS# | 101827-46-7 |
| Purity | ≥98% |
| SMILES | CN(CC1=CC=C(C(C)(C)C)C=C1)CC2=C3C=CC=CC3=CC=C2.[H]Cl |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/butenafine-hcl.html |