Buparvaquone
Buparvaquone is a hydroxynaphthoquinone antiprotozoal drug related to parvaquone and atovaquone and it is a promising compound for the therapy and prophylaxis of all forms of theileriosis.
| Trivial name | Butalex |
| Catalog Number | CSN10508 |
| Alternative Name(s) | Butalex |
| Research Area | Infection |
| Molecular Formula | C21H26O3 |
| CAS# | 88426-33-9 |
| Purity | ≥98% |
| SMILES | O=C1C(CC2CCC(C(C)(C)C)CC2)=C(O)C(C3=C1C=CC=C3)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/buparvaquone.html |
