Arg-Gly-Asp-Ser
Arg-Gly-Asp-Ser is a synthetic integrin antagonist, a specific peptide motif through which extracellular matrix (ECM) components interact with integrin and can modify the behavior of cells.
Trivial name | RGDS Peptide |
Catalog Number | CSN10335 |
Alternative Name(s) | RGDS Peptide |
Research Area | Cancer |
Molecular Formula | C15H27N7O8 |
CAS# | 91037-65-9 |
Purity | ≥98% |
SMILES | O=C(NCC(N[C@@H](CC(O)=O)C(N[C@@H](CO)C(O)=O)=O)=O)[C@H](CCCNC(N)=N)N |
Size | 10mg |
Supplier Page | https://www.csnpharm.com/products/arg-gly-asp-ser.html |