Arg-Gly-Asp-Ser
Arg-Gly-Asp-Ser is a synthetic integrin antagonist, a specific peptide motif through which extracellular matrix (ECM) components interact with integrin and can modify the behavior of cells.
| Trivial name | RGDS Peptide |
| Catalog Number | CSN10335 |
| Alternative Name(s) | RGDS Peptide |
| Research Area | Cancer |
| Molecular Formula | C15H27N7O8 |
| CAS# | 91037-65-9 |
| Purity | ≥98% |
| SMILES | O=C(NCC(N[C@@H](CC(O)=O)C(N[C@@H](CO)C(O)=O)=O)=O)[C@H](CCCNC(N)=N)N |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/arg-gly-asp-ser.html |
