Anisomycin
Anisomycin is a naturally occuring antibiotic which can act as a potent activator of stress-activated protein kinases (JNK/SAPK) and p38 MAPK, and also can inhibit protein synthesis by blocking translation.
| Trivial name | Flagecidin; Wuningmeisu C |
| Catalog Number | CSN10317 |
| Alternative Name(s) | Flagecidin; Wuningmeisu C |
| Research Area | Infection |
| Molecular Formula | C14H19NO4 |
| CAS# | 22862-76-6 |
| Purity | ≥98% |
| SMILES | O[C@@H]1[C@@H](OC(C)=O)[C@@H](CC2=CC=C(OC)C=C2)NC1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/anisomycin.html |