Dihydromyricetin
Dihydromyricetin (DHM), a natural flavonoid compound, has functions like anti-alcohol effects, anti-oxidation, anti-thrombosis, and anti-inflammatory and so on. It could reduce the effect alcohol has on GABA receptors in the brain.
| Trivial name | Ampeloptin |
| Catalog Number | CSN10298 |
| Alternative Name(s) | Ampeloptin |
| Research Area | Cancer |
| Molecular Formula | C15H12O8 |
| CAS# | 27200-12-0 |
| Purity | ≥99% |
| SMILES | O=C1[C@H](O)[C@@H](C2=CC(O)=C(O)C(O)=C2)OC3=CC(O)=CC(O)=C13 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dihydromyricetin.html |
