Amezinium Methylsulfate
Amezinium methylsulfate can stimulate α and β-1 receptors and inhibit noradrenaline and tyramine uptake, used as a sympathomimetic drug for the treatment of low blood pressure.
| Trivial name | Amezinium Metilsulfate; Lu-1631 |
| Catalog Number | CSN10277 |
| Alternative Name(s) | Amezinium Metilsulfate; Lu-1631 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C12H15N3O5S |
| CAS# | 30578-37-1 |
| Purity | ≥98% |
| SMILES | COC1=CC(N)=CN=[N+]1C2=CC=CC=C2.O=S(OC)([O-])=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/amezinium-methylsulfate.html |