Amentoflavone
Amentoflavone is an inhibitor of human UDP-glucuronosyltransferases with anti-inflammatory, antioxidative, and neuroprotective effects and it can be isolated from the seeds of Ginkgo biloba L. Amentoflavone inhibited SARS-CoV 3CL(pro) with IC50 value of 8.3μM.
| Trivial name | Didemethyl-Ginkgetin |
| Catalog Number | CSN10276 |
| Alternative Name(s) | Didemethyl-Ginkgetin |
| Research Area | Infection |
| Molecular Formula | C30H18O10 |
| CAS# | 1617-53-4 |
| Purity | ≥99% |
| SMILES | O=C1C=C(C2=CC=C(O)C=C2)OC3=C(C4=CC(C5=CC(C6=C(O)C=C(O)C=C6O5)=O)=CC=C4O)C(O)=CC(O)=C13 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/amentoflavone.html |
