Azathramycin
Azathramycin is an antibiotic used for the treatment of a number of bacterial infections with elimination half-life of 11–14 h.
| Trivial name | Azaerythromycin A; 9-Deoxo-9a-Aza-9a-homoerythromycin A; Desmethyl Azithromycin |
| Catalog Number | CSN10188 |
| Alternative Name(s) | Azaerythromycin A; 9-Deoxo-9a-Aza-9a-homoerythromycin A; Desmethyl Azithromycin |
| Research Area | Infection |
| Molecular Formula | C37H70N2O12 |
| CAS# | 76801-85-9 |
| Purity | ≥98% |
| SMILES | C[C@H]1[C@H](O)[C@](C)(OC)C[C@]([H])(O[C@@H]([C@H](C)[C@@H](O[C@@]2([H])[C@H](O)[C@@H](N(C)C)C[C@@H](C)O2)[C@](C)(O)C[C@@H](C)CN[C@H](C)[C@@H](O)[C@@](O)(C)[C@@H](CC)O3)[C@@H](C)C3=O)O1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/azathramycin.html |