Pizotifen Malate
Pizotifen Malate is a benzocycloheptene-based drug used to reduce the frequency of recurrent migraine headacheswith, with high affinity for 5-HT and dopamine receptors (Kis = 7.94 and 2.4 nM for 5-HT2C and D2, respectively).
Trivial name | BC-105 |
Catalog Number | CSN10104 |
Alternative Name(s) | BC-105 |
Research Area | Neurological Disease |
Molecular Formula | C23H27NO5S |
CAS# | 5189-11-7 |
Purity | ≥99% |
SMILES | O=C(O)C(O)CC(O)=O.CN1CC/C(CC1)=C2C3=CC=CC=C3CCC4=C\2C=CS4 |
Size | 250mg |
Supplier Page | https://www.csnpharm.com/products/pizotifen-malate.html |