Dacarbazine
Dacarbazine is an antineoplastic agent with significant activity against melanomas, by acting as an alkylating agent and inhibiting DNA synthesis as a purine analog
| Trivial name | DTIC-Dome; Imidazole Carboxamide; DTIC |
| Catalog Number | CSN10080 |
| Alternative Name(s) | DTIC-Dome; Imidazole Carboxamide; DTIC |
| Research Area | Cancer |
| Molecular Formula | C6H10N6O |
| CAS# | 4342-03-4 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(/N=N/N(C)C)N=CN1)N |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dacarbazine.html |