Benzethonium Chloride
Benzethonium chloride can inhibit nAChRs with IC50 values of 49 nM and 122 nM for α4β2 nAChRs and α7 nAChRs, respectively. It is a synthetic quaternary ammonium salt with surfactant, antiseptic, and broad spectrum antimicrobial properties.
| Trivial name | Phemerol Chloride; Hyamine-1622 |
| Catalog Number | CSN10072 |
| Alternative Name(s) | Phemerol Chloride; Hyamine-1622 |
| Research Area | Neurological Disease |
| Molecular Formula | C27H42ClNO2 |
| CAS# | 121-54-0 |
| Purity | ≥99% |
| SMILES | CC(C1=CC=C(C=C1)OCCOCC[N+](C)(CC2=CC=CC=C2)C)(CC(C)(C)C)C.[Cl-] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/benzethonium-chloride.html |