Tazarotene
Tazarotene selectively binds to retinoic acid receptors RAR-β and RAR-γ, it is the first receptor-selective aromatic retinoid that has effective treatment for psoriasis, hemorrhoids.
| Trivial name | AGN 190168 |
| Catalog Number | CSN16696 |
| Alternative Name(s) | AGN 190168 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C21H21NO2S |
| CAS# | 118292-40-3 |
| Purity | ≥97% |
| SMILES | O=C(C1=CC=C(C#CC2=CC=C3C(C(C)(C)CCS3)=C2)N=C1)OCC |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tazarotene.html |
