9-Aminocamptothecin
9-Aminocamptothecin, a natural product isolated and purified from the barks of Camptotheca acuminata Decne, is an active derivative of camptothecin, which belongs to the general group of chemotherapy drugs called topoisomerase inhibitors. 9-Aminocamptothecin is an inhibitor of Topo I.
| Trivial name | / |
| Catalog Number | CSN13080 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C20H17N3O4 |
| CAS# | 91421-43-1 |
| Purity | ≥97% |
| SMILES | O=C1[C@](O)(CC)C2=C(CO1)C(N3CC4=CC5=C(N)C=CC=C5N=C4C3=C2)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/9-aminocamptothecin.html |