2′-Deoxyguanosine
2′-Deoxyguanosine kind of purine nucleoside composed of the purine nucleoside guanine linked by its N9 nitrogen to the C1 carbon of deoxyribose. It can be used for the quantification of whole cell dNTP (deoxyribonucleotide triphosphate), stromal cell purification, oxidative research, etc.
| Trivial name | Deoxyguanosine |
| Catalog Number | CSN19315 |
| Alternative Name(s) | Deoxyguanosine |
| Research Area | / |
| Molecular Formula | C10H13N5O4 |
| CAS# | 961-07-9 |
| Purity | ≥95% |
| SMILES | O=C1N=C(N)NC2=C1N=CN2[C@@H]3O[C@H](CO)[C@@H](O)C3 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/2'-deoxyguanosine.html |