Crotonoside
Crotonoside is a naturally occurring active isomer of guanosine found in the seeds of Croton tiglium, which could reduce the blood pressure in rabbits and cats.
| Trivial name | 2-Hydroxyadenosine; 2-Oxoadenosine; 2-Oxo-Ado |
| Catalog Number | CSN18820 |
| Alternative Name(s) | 2-Hydroxyadenosine; 2-Oxoadenosine; 2-Oxo-Ado |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C10H13N5O5 |
| CAS# | 1818-71-9 |
| Purity | ≥95% |
| SMILES | OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(O)N=C3N)O1)O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/crotonoside.html |