Liothyronin Sodium
Liothyronin Sodium a synthetic form of the levorotatory isomer of the naturally occurring thyroid hormone triiodothyronine, used to treat hypothyroidism.
| Trivial name | T3 Sodium Salt; Sodium L-3,3',5-Triiodothyronine |
| Catalog Number | CSN10110 |
| Alternative Name(s) | T3 Sodium Salt; Sodium L-3,3',5-Triiodothyronine |
| Research Area | Endocrinology |
| Molecular Formula | C15H11I3NNaO4 |
| CAS# | 55-06-1 |
| Purity | ≥91% |
| SMILES | O=C([O-])[C@@H](N)CC1=CC(I)=C(OC2=CC=C(O)C(I)=C2)C(I)=C1.[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/liothyronin-sodium.html |