Crystal Violet
Crystal violet, a triphenylmethane dye, is used in histological staining and gram stain tests to distinguish between different classes of bacteria.
| Trivial name | Basic Violet 3; Gentian Violet; Hexamethylpararosaniline Chloride; Methyl Violet-10B |
| Catalog Number | CSN10710 |
| Alternative Name(s) | Basic Violet 3; Gentian Violet; Hexamethylpararosaniline Chloride; Methyl Violet-10B |
| Research Area | / |
| Molecular Formula | C25H30ClN3 |
| CAS# | 548-62-9 |
| SMILES | C/[N+](C)=C1C=C/C(C=C/1)=C(C2=CC=C(N(C)C)C=C2)\C3=CC=C(N(C)C)C=C3.[Cl-] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/crystal-violet.html |