Lutein
Lutein is a natural product isolated and purified from the herbs of Tagetes erecta with antitumour, antimutagenic and a wide range of antimicrobial action, and is potentially useful for treating macular degeneration.
| Trivial name | Xanthophyll |
| Catalog Number | CSN16608 |
| Alternative Name(s) | Xanthophyll |
| Research Area | Cancer|Infection |
| Molecular Formula | C40H56O2 |
| CAS# | 127-40-2 |
| Purity | 80% |
| SMILES | CC1([C@H](C(C)=C[C@@H](C1)O)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(C[C@H](CC2(C)C)O)C)C)C)C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/lutein.html |