Bazedoxifene D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-48589 |
| Alternative Name(s) | 1-[[4-[2-(Hexahydro-1H-azepin-1-yl)ethoxy-1,1,2,2-d4]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methyl-1HIndol-5-ol;1‐({4‐[2‐(azepan‐1‐yl (D4)ethoxy]phenyl}methyl)‐2‐ (4‐hydroxyphenyl)‐3‐methyl‐1H‐indol‐5‐ol. |
| Research Area | Bazedoxifene-d4 is a labeled nonsteroidal selective estrogen receptor modulator (SERM). Bazedoxifene is used as an antiosteoporotic. ;Labeled Bazedoxifene, intended for use as an internal standard for the quantification of Bazedoxifene by GC- or LC-mass spectrometry. |
| Molecular Formula | C30H30D4N2O3 |
| CAS# | 1133695-49-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C2=CC=C(O)C=C2)N(C3=CC=C(O)C=C31)CC4=CC=C(OC([2H])([2H])C([2H])([2H])N5CCCCCC5)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST48589.html |
| Additional Information | NULL |