Centchroman D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16495 |
| Alternative Name(s) | 1-(2-{4-[(3S,4S)-7-methoxy-2,2-di(D3)methyl-3-phenyl-3,4-dihydro-2H-1-benzopyran-4-yl]phenoxy}ethyl)pyrrolidine |
| Research Area | Labeled Centchroman, intended for use as an internal standard for the quantification of Centchroman by GC- or LC-mass spectrometry. |
| Molecular Formula | C30H29D6NO3 |
| CAS# | 31477-60-8(Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | COC1=CC=C2[C@H](C3=CC=C(OCCN4CCCC4)C=C3)[C@@H](C5=CC=CC=C5)C(C([2H])([2H])[2H])(OC2=C1)C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16495.html |
| Additional Information | NULL |