Rizatriptan D6 Benzoate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02848 |
| Alternative Name(s) | N,N-(Dimethyl-d6)-5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indole-3-ethanamine Benzoate |
| Research Area | Labeled Rizatriptan, intended for use as an internal standard for the quantification of Rizatriptan by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H19D6N5O2 |
| CAS# | 1216984-85-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C1=CC=CC=C1)=O.[2H]C([2H])([2H])N(C([2H])([2H])[2H])CCC2=CNC3=CC=C(CN4C=NC=N4)C=C23 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02848.html |
| Additional Information | NULL |