β-Caryophyllene
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-T-10638 |
| Alternative Name(s) | (1R,4E,9S)-4,11,11-Trimethyl-8-methylenc-4-ene;(1R,4E,9S)-4,11,11-Trimethyl-8-methylenc-4-ene;: (1R,4E,9S)-4,11,11-Trimethyl-8-methylenebicyclo[7.2.0]undec-4-ene; (-)-(E)-Caryophyllene; (-)-Caryophyllene; (-)-E-Caryophyllene; (-)-trans-Caryophyllene; (-)-β-Caryophyllene; (E)-Caryophyllene; Caryophyllene; Caryophyllene B; NSC 11906; l-Caryophyllene; trans-Caryophyllene; trans-β-Caryophyllene; β-Caryophyllen; (-)-β-Caryophyllene; |
| Research Area | -Beta-Caryophyllene is notable for having a cyclobutane ring, a rarity in nature. -Beta-Caryophyllene is one of the chemical compounds that contributes to the spiciness of black pepper. -Beta-Caryophyllene was shown to selectively bind to the cannabinoid |
| Molecular Formula | C15H24 |
| CAS# | 87-44-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1([C@@](CC/C(C)=CCCC2=C)([H])[C@]2([H])C1)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST10638.html |
| Additional Information | NULL |