Thiamine EP Impurity E
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-31156 |
| Alternative Name(s) | Thiamine EP Impurity A;Thioxothiamine; Thiamine Impurity E;CS-P-00223 ; Thiothiamin |
| Research Area | Thiothiamine is an impurity of Thiamine . Thiothiamine inhibits the activity of glutamate decarboxylase and decreases the concentration of GABA in brain tissue. |
| Molecular Formula | C12H16N4OS2 |
| CAS# | 299-35-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(N1CC2=CN=C(C)N=C2N)=C(CCO)SC1=S |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31156.html |
| Additional Information | NULL |