(S)-(-)-Anatabine
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-03776 |
| Alternative Name(s) | (2S)-1,2,3,6-Tetrahydro-2,3-bipyridine;(S)-1,2,3,6-tetrahydro-2,3-bipyridine |
| Research Area | The (S)-metabolite of Nicotine . |
| Molecular Formula | C10H12N2 |
| CAS# | 581-49-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C1([C@@H]2CC=CCN2)=CN=CC=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST03776.html |
| Additional Information | NULL |