Methylphenidate Hydrochloride Erythro Isomer
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-14176 |
| Alternative Name(s) | Methylphenidate Hydrochloride Erythro Isomer;Rac-erythro Methylphenidate Hydrochloride;(-)-erythro-Methylphenidate Hydrochloride;Methylphenidate erythro isomer of Methylphenidate;(R)-methyl 2-phenyl-2-((R)-piperidin-2-yl)acetate;(+/-)-erythro-Meridil;(R*,S*)-(+/-)-|A-Phenyl-2-piperidineacetic Acid Methyl Ester Hydrochloride;(2S,2 inverted exclamation mark R)-(-)-threo-Methyl |A-Phenyl-|A-(2-piperidyl)acetate Hydrochloride;23644-60-2;D-erythro-Methylphenidate Hydrochloride; Rac-erythro Methylphenidate Hydrochloride; (-)-erythro-Methylphenidate Hydrochloride; (|AR,2S)-rel-|A-Phenyl-2-piperidineacetic Acid Methyl Ester Hydrochloride;(2S,2R)-(-)-threo-methyl a-phenyl-a-(2-piperidyl)acetate hydrochloride;(2R,2S)-(+)-threo-methyl a-phenyl-a-(2-piperidyl)acetate hydrochloride (a-R,2S)-a-Phenyl-2-piperidineacetic Acid Methyl Ester Hydrochloride;Methylphenidate erythro isomer of Methylphenidate. |
| Research Area | NULL |
| Molecular Formula | C14H20ClNO2 |
| CAS# | 40431-63-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC)[C@H]([C@@]1([H])CCCCN1)C2=CC=CC=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14176.html |
| Additional Information | NULL |