Metoprolol Tartrate (1441301)
USP Standards
| Trivial name | NULL |
| Catalog Number | CS-EB-02317 |
| Alternative Name(s) | (2R,3S)-2,3-dihydroxybutanedioic acid;1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol; 1-[4-(2-Methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol Hemi (+)-Tartrate; Beloc; Betaloc; Lapressor; Prelis; Seloken; Selopral; |
| Research Area | A β1 selective aryloxypropanolamine andrenergic antagonist which is used in the treatment of a variety of cardiovascular disorder (1,2). Antihypertensive; antianginal; antiarrhythmic (class II). |
| Molecular Formula | C34H56N2O12 |
| CAS# | 56392-17-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOC)O.CC(C)NCC(COC1=CC=C(C=C1)CCOC)O.C(C(C(=O)O)O)(C(=O)O)O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSEB02317.html |
| Additional Information | NULL |