(S)-Bendroflumethiazide
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-10827 |
| Alternative Name(s) | (3S)-3-benzyl-1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| Research Area | The S-enatiomer of the diuretic Bendroflumethiazide . |
| Molecular Formula | NULL |
| CAS# | 1245935-40-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S]1(C2=CC([S](N)(=O)=O)=C(C(F)(F)F)C=C2N[C@H](CC3=CC=CC=C3)N1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10827.html |
| Additional Information | NULL |