Bazedoxifene D4 Acetate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-48590 |
| Alternative Name(s) | 1133695-49-4; 1-[[4-[2-(Hexahydro-1H-azepin-1-yl)(ethoxy-d4)]phenyl]methyl]-2-(4-hydroxyphenyl)-3-methyl-1H-indol-5-ol Acetate |
| Research Area | Laballed Bazedoxifene Acetate. Bazedoxifene Acetate is a nonsteroidal selective estrogen receptor modulator (SERM). Bazedoxifene Acetate is used as an antiosteoporotic. ;Labeled Bazedoxifene, intended for use as an internal standard for the quantification of Bazedoxifene by GC- or LC-mass spectrometry. |
| Molecular Formula | C32H34D4N2O5 |
| CAS# | 1795027-71-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(O)=O.CC1=C(C2=CC=C(O)C=C2)N(C3=CC=C(O)C=C31)CC4=CC=C(OC([2H])([2H])C([2H])([2H])N5CCCCCC5)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST48590.html |
| Additional Information | NULL |