Oxolinic acid D5
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00318 |
| Alternative Name(s) | 5-[(1,1,2,2,2-2H5)ethyl]-8-oxo-2H,5H,8H- [1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid |
| Research Area | Labeled Oxolinic acid, intended for use as an internal standard for the quantification of Oxolinic acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C13D5H6NO5 |
| CAS# | 1189890-98-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=C(C=C(OCO3)C3=C2)N(C=C1C(O)=O)C([2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00318.html |
| Additional Information | NULL |