Acrylamide D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-47441 |
| Alternative Name(s) | (D3)prop-2-enamide ; 2-Propenamide-d3; Acrylic Amide-d3 |
| Research Area | Used as chemical intermediate in production of polyacrylamides, for use in protein electrophoresis (PAGE), synthesis of dyes and copolymers for contact lenses. It is reasonably anticipated to be a human carcinogen. |
| Molecular Formula | NULL |
| CAS# | 122775-19-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(/C([2H])=C([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST47441.html |
| Additional Information | NULL |