Cyclosporine D
API Standards
| Trivial name | NULL |
| Catalog Number | CS-O-30884 |
| Alternative Name(s) | Val2-cyclosporin; 7-L-Valine-cyclosporin A;(3S,6S,9S,12R,15S,18S,21S,24S,30S)-33-((1R,2R,E)-1-hydroxy-2-methylhex-4-en-1-yl)-6,9,18,24-tetraisobutyl-3,21,30-triisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-1,4,7,10,13,16,19,22,25,28,31-u14,17,20,23,26,29,32-undecaone. |
| Research Area | A group of nonpolar cyclic oligopeptides with immunosupppressant activity. |
| Molecular Formula | C63H113N11O12 |
| CAS# | 63775-96-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H]([C@](C(N[C@H](C(N(CC(N([C@H](C(N[C@@](C(N([C@H]1CC(C)C)C)=O)([H])C(C)C)=O)CC(C)C)C)=O)C)=O)C(C)C)=O)([H])N(C([C@](N(C([C@@H](N(C([C@](N(C([C@H](NC([C@@H](NC1=O)C)=O)C)=O)C)([H])CC(C)C)=O)C)CC(C)C)=O)C)([H])C(C)C)=O)C)[C@H](C)C/C=C/C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30884.html |
| Additional Information | NULL |