Ritonavir D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02715 |
| Alternative Name(s) | thiazol-5-ylmethyl ((2S,3S,5S)-3-hydroxy-5-((S)-2-(3-((2-isopropylthiazol-4-yl)methyl)-3-methylureido)-3-methylbutanamido)-1,6-diphenylhexan-2-yl)carbamate-d8 |
| Research Area | Labeled Ritonavir, intended for use as an internal standard for the quantification of Ritonavir by GC- or LC-mass spectrometry. |
| Molecular Formula | C37H40D8N6O5S2 |
| CAS# | 155213-67-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(CC1=CSC(C(C)C)=N1)C)NC(C(N[C@@H](CC2=CC=CC=C2)C[C@@H]([C@@H](NC(OCC3=CN=CS3)=O)CC4=CC=CC=C4)O)=O)([2H])C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02715.html |
| Additional Information | NULL |