Lumacaftor D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-P-08060 |
| Alternative Name(s) | 3-{6-[1-(2,2-difluoro-2H-1,3-benzodioxol-5-yl)(2,2,3,3-D4)cyclopropaneamido]-3-methylpyridin-2-yl}benzoic acid |
| Research Area | Labeled Lumacaftor, intended for use as an internal standard for the quantification of Lumacaftor by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H14D4F2N2O5 |
| CAS# | 936727-05-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1(C2=CC=C3C(OC(F)(F)O3)=C2)C([2H])([2H])C1([2H])[2H])NC4=CC=C(C)C(C5=CC(C(O)=O)=CC=C5)=N4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSP08060.html |
| Additional Information | NULL |